What is the 4-AMINO-3,5-DINITROBENZAMIDE?

4-AMINO-3,5-DINITROBENZAMIDE is , while it's Molecular Formula is C7H6N4O5. Used in Pharmaceutical Industry: 4-Amino-3,5-dinitrobenzamide is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows it to be incorporated into the development of new drugs, contributing to the advancement of medicine and healthcare. Used in Dye and Pigment Industry: In the dye and pigment industry, 4-amino-3,5-dinitrobenzamide is utilized as a starting material for the production of various dyes and pigments. Its chemical properties enable the creation of a wide range of colors, enhancing the diversity of products available in the market. Used in Organic Synthesis: 4-Amino-3,5-dinitrobenzamide serves as a valuable reagent in organic synthesis, facilitating various chemical reactions and transformations. Its presence in the reaction mixture can significantly improve the efficiency and selectivity of the process, leading to the production of desired compounds with higher yields. Used in Chemical Compound Manufacturing: As an intermediate in the manufacturing of other chemical compounds, 4-amino-3,5-dinitrobenzamide plays a crucial role in the synthesis of a variety of products. Its versatile chemical properties make it a valuable component in the production of various industrial chemicals, contributing to the overall chemical industry's growth and development.

What is the CAS number for 4-AMINO-3,5-DINITROBENZAMIDE?

The CAS number of 4-AMINO-3,5-DINITROBENZAMIDE is 54321-79-8.

What is 4-AMINO-3,5-DINITROBENZAMIDE (54321-79-8) used for?

4-Amino-3,5-dinitrobenzamide, a chemical compound with the molecular formula C7H6N4O5, is a yellow crystalline solid that is sparingly soluble in water. It is primarily used in various industrial applications, including the production of pharmaceuticals, dyes, and pigments. Additionally, it serves as a reagent in organic synthesis and an intermediate in the manufacturing of other chemical compounds. Due to its potential health hazards, such as skin and eye irritation, and environmental hazards, 4-amino-3,5-dinitrobenzamide should be handled with caution.InChI:InChI=1/C7H6N4O5/c8-6-4(10(13)14)1-3(7(9)12)2-5(6)11(15)16/h1-2H,8H2,(H2,9,12)

What is the 4-AMINO-3,5-DINITROBENZAMIDE?

4-AMINO-3,5-DINITROBENZAMIDE is , while it's Molecular Formula is C7H6N4O5. Used in Pharmaceutical Industry: 4-Amino-3,5-dinitrobenzamide is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows it to be incorporated into the development of new drugs, contributing to the advancement of medicine and healthcare. Used in Dye and Pigment Industry: In the dye and pigment industry, 4-amino-3,5-dinitrobenzamide is utilized as a starting material for the production of various dyes and pigments. Its chemical properties enable the creation of a wide range of colors, enhancing the diversity of products available in the market. Used in Organic Synthesis: 4-Amino-3,5-dinitrobenzamide serves as a valuable reagent in organic synthesis, facilitating various chemical reactions and transformations. Its presence in the reaction mixture can significantly improve the efficiency and selectivity of the process, leading to the production of desired compounds with higher yields. Used in Chemical Compound Manufacturing: As an intermediate in the manufacturing of other chemical compounds, 4-amino-3,5-dinitrobenzamide plays a crucial role in the synthesis of a variety of products. Its versatile chemical properties make it a valuable component in the production of various industrial chemicals, contributing to the overall chemical industry's growth and development.

What is the CAS number for 4-AMINO-3,5-DINITROBENZAMIDE?

The CAS number of 4-AMINO-3,5-DINITROBENZAMIDE is 54321-79-8.

What is 4-AMINO-3,5-DINITROBENZAMIDE (54321-79-8) used for?

4-Amino-3,5-dinitrobenzamide, a chemical compound with the molecular formula C7H6N4O5, is a yellow crystalline solid that is sparingly soluble in water. It is primarily used in various industrial applications, including the production of pharmaceuticals, dyes, and pigments. Additionally, it serves as a reagent in organic synthesis and an intermediate in the manufacturing of other chemical compounds. Due to its potential health hazards, such as skin and eye irritation, and environmental hazards, 4-amino-3,5-dinitrobenzamide should be handled with caution.InChI:InChI=1/C7H6N4O5/c8-6-4(10(13)14)1-3(7(9)12)2-5(6)11(15)16/h1-2H,8H2,(H2,9,12)

Your Location:Home > Others > 4-AMINO-3,5-DINITROBENZAMIDE

Product classification

4-AMINO-3,5-DINITROBENZAMIDE

Name: 4-AMINO-3,5-DINITROBENZAMIDE
CAS: 54321-79-8
Purity: 99%

Inquiry

Details

Cost-effective and customizable 4-AMINO-3,5-DINITROBENZAMIDE 54321-79-8 in stock

Molecular Formula: C7H6N4O5
Molecular Weight: 226.148
Vapor Pressure: 3.76E-05mmHg at 25°C
Melting Point: 251-254 °C(lit.)
Refractive Index: 1.711
Boiling Point: 352.7 °C at 760 mmHg
Flash Point: 167.1 °C
PSA： 160.75000
Density: 1.686 g/cm³
LogP: 2.51200

4-AMINO-3,5-DINITROBENZAMIDE(Cas 54321-79-8) Usage

General Description

4-Amino-3,5-dinitrobenzamide is a chemical compound with the molecular formula C7H6N4O5. It is a yellow crystalline solid that is sparingly soluble in water. 4-AMINO-3,5-DINITROBENZAMIDE is primarily used in the production of pharmaceuticals, dyes, and pigments. It is also used as a reagent in organic synthesis and as an intermediate in the manufacturing of other chemical compounds. 4-Amino-3,5-dinitrobenzamide should be handled with caution due to its potential health hazards, including skin and eye irritation, as well as potential environmental hazards.

InChI:InChI=1/C7H6N4O5/c8-6-4(10(13)14)1-3(7(9)12)2-5(6)11(15)16/h1-2H,8H2,(H2,9,12)